C17H21F3IN4O2- — CID 163940835
(E)-3-[1-[[butyl(2,2,2-trifluoroethyl)amino]methyliodanuidyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 163940835) has the molecular formula C17H21F3IN4O2- and a molecular weight of 497.28 g/mol. Its IUPAC name is (E)-3-[1-[[butyl(2,2,2-trifluoroethyl)amino]methyliodanuidyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[1-[[butyl(2,2,2-trifluoroethyl)amino]methyliodanuidyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 163940835 |
| Molecular Formula | C17H21F3IN4O2- |
| Molecular Weight | 497.28 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | (E)-3-[1-[[butyl(2,2,2-trifluoroethyl)amino]methyliodanuidyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | CCCCN(C[I-]n1cnc2cc(/C=C/C(=O)NO)ccc21)CC(F)(F)F |
| InChI | InChI=1S/C17H21F3IN4O2/c1-2-3-8-24(10-17(18,19)20)11-21-25-12-22-14-9-13(4-6-15(14)25)5-7-16(26)23-27/h4-7,9,12,27H,2-3,8,10-11H2,1H3,(H,23,26)/q-1/b7-5+ |
| InChIKey | VSAFQBLCGNNELX-FNORWQNLSA-N |
| XLogP | 0.03 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.28 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|