C20H30N4O2 — CID 57429931
(E)-3-[1-[2-[2,2-dimethylpropyl(propyl)amino]ethyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 57429931) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is (E)-3-[1-[2-[2,2-dimethylpropyl(propyl)amino]ethyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[1-[2-[2,2-dimethylpropyl(propyl)amino]ethyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 57429931 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | (E)-3-[1-[2-[2,2-dimethylpropyl(propyl)amino]ethyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | CCCN(CCn1cnc2cc(/C=C/C(=O)NO)ccc21)CC(C)(C)C |
| InChI | InChI=1S/C20H30N4O2/c1-5-10-23(14-20(2,3)4)11-12-24-15-21-17-13-16(6-8-18(17)24)7-9-19(25)22-26/h6-9,13,15,26H,5,10-12,14H2,1-4H3,(H,22,25)/b9-7+ |
| InChIKey | IGWFCLSNTJQSHF-VQHVLOKHSA-N |
| XLogP | 3.31 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|