C17H22F2N4O2 — CID 88934376
(E)-3-[2-(2,2-difluoropropyl)-1-[2-(dimethylamino)ethyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 88934376) has the molecular formula C17H22F2N4O2 and a molecular weight of 352.39 g/mol. Its IUPAC name is (E)-3-[2-(2,2-difluoropropyl)-1-[2-(dimethylamino)ethyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[2-(2,2-difluoropropyl)-1-[2-(dimethylamino)ethyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 88934376 |
| Molecular Formula | C17H22F2N4O2 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (E)-3-[2-(2,2-difluoropropyl)-1-[2-(dimethylamino)ethyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | CN(C)CCn1c(CC(C)(F)F)nc2cc(/C=C/C(=O)NO)ccc21 |
| InChI | InChI=1S/C17H22F2N4O2/c1-17(18,19)11-15-20-13-10-12(5-7-16(24)21-25)4-6-14(13)23(15)9-8-22(2)3/h4-7,10,25H,8-9,11H2,1-3H3,(H,21,24)/b7-5+ |
| InChIKey | VXPCKKVVBBILLG-FNORWQNLSA-N |
| XLogP | 2.31 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|