C24H32F6N4O6 — CID 53364054
(E)-3-[2-butyl-1-[3-(propan-2-ylamino)propyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 53364054) has the molecular formula C24H32F6N4O6 and a molecular weight of 586.53 g/mol. Its IUPAC name is (E)-3-[2-butyl-1-[3-(propan-2-ylamino)propyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (E)-3-[2-butyl-1-[3-(propan-2-ylamino)propyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 53364054 |
| Molecular Formula | C24H32F6N4O6 |
| Molecular Weight | 586.53 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | (E)-3-[2-butyl-1-[3-(propan-2-ylamino)propyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCCCc1nc2cc(/C=C/C(=O)NO)ccc2n1CCCNC(C)C.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H30N4O2.2C2HF3O2/c1-4-5-7-19-22-17-14-16(9-11-20(25)23-26)8-10-18(17)24(19)13-6-12-21-15(2)3;2*3-2(4,5)1(6)7/h8-11,14-15,21,26H,4-7,12-13H2,1-3H3,(H,23,25);2*(H,6,7)/b11-9+;; |
| InChIKey | RCTLMCASPMPVQB-OTBYXNOXSA-N |
| XLogP | 4.55 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|