C22H33N3O2 — CID 53363348
methyl (E)-3-[2-hexyl-1-[2-(propan-2-ylamino)ethyl]benzimidazol-5-yl]prop-2-enoate (PubChem CID 53363348) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is methyl (E)-3-[2-hexyl-1-[2-(propan-2-ylamino)ethyl]benzimidazol-5-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[2-hexyl-1-[2-(propan-2-ylamino)ethyl]benzimidazol-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 53363348 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | methyl (E)-3-[2-hexyl-1-[2-(propan-2-ylamino)ethyl]benzimidazol-5-yl]prop-2-enoate |
| SMILES | CCCCCCc1nc2cc(/C=C/C(=O)OC)ccc2n1CCNC(C)C |
| InChI | InChI=1S/C22H33N3O2/c1-5-6-7-8-9-21-24-19-16-18(11-13-22(26)27-4)10-12-20(19)25(21)15-14-23-17(2)3/h10-13,16-17,23H,5-9,14-15H2,1-4H3/b13-11+ |
| InChIKey | OHCOMXGCTBMLDG-ACCUITESSA-N |
| XLogP | 4.34 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|