C24H35N3O2 — CID 53363516
methyl (E)-3-[1-[3-(dimethylamino)-2,2-dimethylpropyl]-2-[(Z)-hex-3-enyl]benzimidazol-5-yl]prop-2-enoate (PubChem CID 53363516) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is methyl (E)-3-[1-[3-(dimethylamino)-2,2-dimethylpropyl]-2-[(Z)-hex-3-enyl]benzimidazol-5-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[1-[3-(dimethylamino)-2,2-dimethylpropyl]-2-[(Z)-hex-3-enyl]benzimidazol-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 53363516 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | methyl (E)-3-[1-[3-(dimethylamino)-2,2-dimethylpropyl]-2-[(Z)-hex-3-enyl]benzimidazol-5-yl]prop-2-enoate |
| SMILES | CC/C=C\CCc1nc2cc(/C=C/C(=O)OC)ccc2n1CC(C)(C)CN(C)C |
| InChI | InChI=1S/C24H35N3O2/c1-7-8-9-10-11-22-25-20-16-19(13-15-23(28)29-6)12-14-21(20)27(22)18-24(2,3)17-26(4)5/h8-9,12-16H,7,10-11,17-18H2,1-6H3/b9-8-,15-13+ |
| InChIKey | MGGPTDFWOJEYRE-VCDVZAPZSA-N |
| XLogP | 4.71 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|