C24H30N4O2S — CID 11774992
(E)-3-[2-benzylsulfanyl-1-[3-(dimethylamino)-2,2-dimethylpropyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 11774992) has the molecular formula C24H30N4O2S and a molecular weight of 438.60 g/mol. Its IUPAC name is (E)-3-[2-benzylsulfanyl-1-[3-(dimethylamino)-2,2-dimethylpropyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[2-benzylsulfanyl-1-[3-(dimethylamino)-2,2-dimethylpropyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 11774992 |
| Molecular Formula | C24H30N4O2S |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | (E)-3-[2-benzylsulfanyl-1-[3-(dimethylamino)-2,2-dimethylpropyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | CN(C)CC(C)(C)Cn1c(SCc2ccccc2)nc2cc(/C=C/C(=O)NO)ccc21 |
| InChI | InChI=1S/C24H30N4O2S/c1-24(2,16-27(3)4)17-28-21-12-10-18(11-13-22(29)26-30)14-20(21)25-23(28)31-15-19-8-6-5-7-9-19/h5-14,30H,15-17H2,1-4H3,(H,26,29)/b13-11+ |
| InChIKey | JISPBCDLHOSGLR-ACCUITESSA-N |
| XLogP | 4.43 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|