C26H34N4O3 — CID 85422002
3-[1-[3-(dimethylamino)-2,2-dimethylpropyl]-2-[2-(3-methoxyphenyl)ethyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 85422002) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is 3-[1-[3-(dimethylamino)-2,2-dimethylpropyl]-2-[2-(3-methoxyphenyl)ethyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[1-[3-(dimethylamino)-2,2-dimethylpropyl]-2-[2-(3-methoxyphenyl)ethyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 85422002 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | 3-[1-[3-(dimethylamino)-2,2-dimethylpropyl]-2-[2-(3-methoxyphenyl)ethyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | COc1cccc(CCc2nc3cc(C=CC(=O)NO)ccc3n2CC(C)(C)CN(C)C)c1 |
| InChI | InChI=1S/C26H34N4O3/c1-26(2,17-29(3)4)18-30-23-12-9-20(11-14-25(31)28-32)16-22(23)27-24(30)13-10-19-7-6-8-21(15-19)33-5/h6-9,11-12,14-16,32H,10,13,17-18H2,1-5H3,(H,28,31) |
| InChIKey | IIBWRLTVYXPCLX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|