C22H32N2 — CID 143424522
N-[2-[2-butyl-5-[(1E)-3-methylbuta-1,3-dienyl]indol-1-yl]ethyl]propan-2-amine (PubChem CID 143424522) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is N-[2-[2-butyl-5-[(1E)-3-methylbuta-1,3-dienyl]indol-1-yl]ethyl]propan-2-amine.
| Compound Name | N-[2-[2-butyl-5-[(1E)-3-methylbuta-1,3-dienyl]indol-1-yl]ethyl]propan-2-amine |
|---|---|
| PubChem CID | 143424522 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | N-[2-[2-butyl-5-[(1E)-3-methylbuta-1,3-dienyl]indol-1-yl]ethyl]propan-2-amine |
| SMILES | C=C(C)/C=C/c1ccc2c(c1)cc(CCCC)n2CCNC(C)C |
| InChI | InChI=1S/C22H32N2/c1-6-7-8-21-16-20-15-19(10-9-17(2)3)11-12-22(20)24(21)14-13-23-18(4)5/h9-12,15-16,18,23H,2,6-8,13-14H2,1,3-5H3/b10-9+ |
| InChIKey | XVGVIAXHEFKZEQ-MDZDMXLPSA-N |
| XLogP | 5.57 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|