C21H32N4O — CID 151041266
N-[(E)-3-[2-hex-3-enyl-1-[2-(propan-2-ylamino)ethyl]benzimidazol-5-yl]prop-1-enyl]hydroxylamine (PubChem CID 151041266) has the molecular formula C21H32N4O and a molecular weight of 356.51 g/mol. Its IUPAC name is N-[(E)-3-[2-hex-3-enyl-1-[2-(propan-2-ylamino)ethyl]benzimidazol-5-yl]prop-1-enyl]hydroxylamine.
| Compound Name | N-[(E)-3-[2-hex-3-enyl-1-[2-(propan-2-ylamino)ethyl]benzimidazol-5-yl]prop-1-enyl]hydroxylamine |
|---|---|
| PubChem CID | 151041266 |
| Molecular Formula | C21H32N4O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | N-[(E)-3-[2-hex-3-enyl-1-[2-(propan-2-ylamino)ethyl]benzimidazol-5-yl]prop-1-enyl]hydroxylamine |
| SMILES | CCC=CCCc1nc2cc(C/C=C/NO)ccc2n1CCNC(C)C |
| InChI | InChI=1S/C21H32N4O/c1-4-5-6-7-10-21-24-19-16-18(9-8-13-23-26)11-12-20(19)25(21)15-14-22-17(2)3/h5-6,8,11-13,16-17,22-23,26H,4,7,9-10,14-15H2,1-3H3/b6-5?,13-8+ |
| InChIKey | MCDFDQORRWBMCN-TUENRLDQSA-N |
| XLogP | 3.97 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|