C20H32N4O — CID 150579798
N-[(E)-3-[2-(2,2-dimethylpropyl)-1-[2-(propan-2-ylamino)ethyl]benzimidazol-5-yl]prop-1-enyl]hydroxylamine (PubChem CID 150579798) has the molecular formula C20H32N4O and a molecular weight of 344.50 g/mol. Its IUPAC name is N-[(E)-3-[2-(2,2-dimethylpropyl)-1-[2-(propan-2-ylamino)ethyl]benzimidazol-5-yl]prop-1-enyl]hydroxylamine.
| Compound Name | N-[(E)-3-[2-(2,2-dimethylpropyl)-1-[2-(propan-2-ylamino)ethyl]benzimidazol-5-yl]prop-1-enyl]hydroxylamine |
|---|---|
| PubChem CID | 150579798 |
| Molecular Formula | C20H32N4O |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | N-[(E)-3-[2-(2,2-dimethylpropyl)-1-[2-(propan-2-ylamino)ethyl]benzimidazol-5-yl]prop-1-enyl]hydroxylamine |
| SMILES | CC(C)NCCn1c(CC(C)(C)C)nc2cc(C/C=C/NO)ccc21 |
| InChI | InChI=1S/C20H32N4O/c1-15(2)21-11-12-24-18-9-8-16(7-6-10-22-25)13-17(18)23-19(24)14-20(3,4)5/h6,8-10,13,15,21-22,25H,7,11-12,14H2,1-5H3/b10-6+ |
| InChIKey | INOUEJAXTGGOCV-UXBLZVDNSA-N |
| XLogP | 3.66 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|