C20H30N4 — CID 143424367
(3E)-N-methyl-4-[1-[2-[propan-2-yl(propyl)amino]ethyl]benzimidazol-5-yl]buta-1,3-dien-2-amine (PubChem CID 143424367) has the molecular formula C20H30N4 and a molecular weight of 326.49 g/mol. Its IUPAC name is (3E)-N-methyl-4-[1-[2-[propan-2-yl(propyl)amino]ethyl]benzimidazol-5-yl]buta-1,3-dien-2-amine.
| Compound Name | (3E)-N-methyl-4-[1-[2-[propan-2-yl(propyl)amino]ethyl]benzimidazol-5-yl]buta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 143424367 |
| Molecular Formula | C20H30N4 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | (3E)-N-methyl-4-[1-[2-[propan-2-yl(propyl)amino]ethyl]benzimidazol-5-yl]buta-1,3-dien-2-amine |
| SMILES | C=C(/C=C/c1ccc2c(c1)ncn2CCN(CCC)C(C)C)NC |
| InChI | InChI=1S/C20H30N4/c1-6-11-23(16(2)3)12-13-24-15-22-19-14-18(9-10-20(19)24)8-7-17(4)21-5/h7-10,14-16,21H,4,6,11-13H2,1-3,5H3/b8-7+ |
| InChIKey | ZJLPHPAIPQKJBL-BQYQJAHWSA-N |
| XLogP | 3.90 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|