C18H23F3N4O2 — CID 76538796
3-[1-[2-[butyl(2,2,2-trifluoroethyl)amino]ethyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 76538796) has the molecular formula C18H23F3N4O2 and a molecular weight of 384.40 g/mol. Its IUPAC name is 3-[1-[2-[butyl(2,2,2-trifluoroethyl)amino]ethyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[1-[2-[butyl(2,2,2-trifluoroethyl)amino]ethyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 76538796 |
| Molecular Formula | C18H23F3N4O2 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 3-[1-[2-[butyl(2,2,2-trifluoroethyl)amino]ethyl]benzimidazol-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | CCCCN(CCn1cnc2cc(C=CC(=O)NO)ccc21)CC(F)(F)F |
| InChI | InChI=1S/C18H23F3N4O2/c1-2-3-8-24(12-18(19,20)21)9-10-25-13-22-15-11-14(4-6-16(15)25)5-7-17(26)23-27/h4-7,11,13,27H,2-3,8-10,12H2,1H3,(H,23,26) |
| InChIKey | DYEKPXGJBKBUJR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|