C22H25N5O — CID 143424525
N'-[amino(methyl)amino]-9-(8-azabicyclo[3.2.1]octan-3-ylidene)xanthene-3-carboximidamide (PubChem CID 143424525) has the molecular formula C22H25N5O and a molecular weight of 375.48 g/mol. Its IUPAC name is N'-[amino(methyl)amino]-9-(8-azabicyclo[3.2.1]octan-3-ylidene)xanthene-3-carboximidamide.
| Compound Name | N'-[amino(methyl)amino]-9-(8-azabicyclo[3.2.1]octan-3-ylidene)xanthene-3-carboximidamide |
|---|---|
| PubChem CID | 143424525 |
| Molecular Formula | C22H25N5O |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | N'-[amino(methyl)amino]-9-(8-azabicyclo[3.2.1]octan-3-ylidene)xanthene-3-carboximidamide |
| SMILES | CN(N)/N=C(\N)c1ccc2c(c1)Oc1ccccc1C2=C1CC2CCC(C1)N2 |
| InChI | InChI=1S/C22H25N5O/c1-27(24)26-22(23)13-6-9-18-20(12-13)28-19-5-3-2-4-17(19)21(18)14-10-15-7-8-16(11-14)25-15/h2-6,9,12,15-16,25H,7-8,10-11,24H2,1H3,(H2,23,26) |
| InChIKey | VYKCITKFYGLHTB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 88.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|