C21H21NO6S — CID 143425084
3-[1-(4-acetylphenyl)sulfinyl-5,6-dimethoxyindol-3-yl]propanoic acid (PubChem CID 143425084) has the molecular formula C21H21NO6S and a molecular weight of 415.47 g/mol. Its IUPAC name is 3-[1-(4-acetylphenyl)sulfinyl-5,6-dimethoxyindol-3-yl]propanoic acid.
| Compound Name | 3-[1-(4-acetylphenyl)sulfinyl-5,6-dimethoxyindol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 143425084 |
| Molecular Formula | C21H21NO6S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 3-[1-(4-acetylphenyl)sulfinyl-5,6-dimethoxyindol-3-yl]propanoic acid |
| SMILES | COc1cc2c(CCC(=O)O)cn(S(=O)c3ccc(C(C)=O)cc3)c2cc1OC |
| InChI | InChI=1S/C21H21NO6S/c1-13(23)14-4-7-16(8-5-14)29(26)22-12-15(6-9-21(24)25)17-10-19(27-2)20(28-3)11-18(17)22/h4-5,7-8,10-12H,6,9H2,1-3H3,(H,24,25) |
| InChIKey | XGQFUDACNYPNFV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |