C21H17ClN2O4 — CID 143425633
3-(6-amino-1,3-dioxobenzo[de]isoquinolin-2-yl)-4-chlorobenzoic acid;ethane (PubChem CID 143425633) has the molecular formula C21H17ClN2O4 and a molecular weight of 396.83 g/mol. Its IUPAC name is 3-(6-amino-1,3-dioxobenzo[de]isoquinolin-2-yl)-4-chlorobenzoic acid;ethane.
| Compound Name | 3-(6-amino-1,3-dioxobenzo[de]isoquinolin-2-yl)-4-chlorobenzoic acid;ethane |
|---|---|
| PubChem CID | 143425633 |
| Molecular Formula | C21H17ClN2O4 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 3-(6-amino-1,3-dioxobenzo[de]isoquinolin-2-yl)-4-chlorobenzoic acid;ethane |
| SMILES | CC.Nc1ccc2c3c(cccc13)C(=O)N(c1cc(C(=O)O)ccc1Cl)C2=O |
| InChI | InChI=1S/C19H11ClN2O4.C2H6/c20-13-6-4-9(19(25)26)8-15(13)22-17(23)11-3-1-2-10-14(21)7-5-12(16(10)11)18(22)24;1-2/h1-8H,21H2,(H,25,26);1-2H3 |
| InChIKey | WBIHJRBKHCOEPN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|