C16H29N3O3 — CID 143425739
2-[2-(2-aminoethylamino)ethylamino]-3-phenylmethoxypropanoic acid;ethane (PubChem CID 143425739) has the molecular formula C16H29N3O3 and a molecular weight of 311.43 g/mol. Its IUPAC name is 2-[2-(2-aminoethylamino)ethylamino]-3-phenylmethoxypropanoic acid;ethane.
| Compound Name | 2-[2-(2-aminoethylamino)ethylamino]-3-phenylmethoxypropanoic acid;ethane |
|---|---|
| PubChem CID | 143425739 |
| Molecular Formula | C16H29N3O3 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 2-[2-(2-aminoethylamino)ethylamino]-3-phenylmethoxypropanoic acid;ethane |
| SMILES | CC.NCCNCCNC(COCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H23N3O3.C2H6/c15-6-7-16-8-9-17-13(14(18)19)11-20-10-12-4-2-1-3-5-12;1-2/h1-5,13,16-17H,6-11,15H2,(H,18,19);1-2H3 |
| InChIKey | FFBNOZDCBNTZDT-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|