C14H23N3NaO3+ — CID 22118026
sodium 2-[2-(2-aminoethylamino)ethylamino]-3-phenylmethoxypropanoic acid (PubChem CID 22118026) has the molecular formula C14H23N3NaO3+ and a molecular weight of 304.35 g/mol. Its IUPAC name is sodium 2-[2-(2-aminoethylamino)ethylamino]-3-phenylmethoxypropanoic acid.
| Compound Name | sodium 2-[2-(2-aminoethylamino)ethylamino]-3-phenylmethoxypropanoic acid |
|---|---|
| PubChem CID | 22118026 |
| Molecular Formula | C14H23N3NaO3+ |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | sodium 2-[2-(2-aminoethylamino)ethylamino]-3-phenylmethoxypropanoic acid |
| SMILES | NCCNCCNC(COCc1ccccc1)C(=O)O.[Na+] |
| InChI | InChI=1S/C14H23N3O3.Na/c15-6-7-16-8-9-17-13(14(18)19)11-20-10-12-4-2-1-3-5-12;/h1-5,13,16-17H,6-11,15H2,(H,18,19);/q;+1 |
| InChIKey | RJANJOMQDRQKED-UHFFFAOYSA-N |
| XLogP | -3.20 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|