C15H12N2O3S — CID 143429124
6-methoxy-2-(4-nitrocyclohepta-1,3,5-trien-1-yl)-1,3-benzothiazole (PubChem CID 143429124) has the molecular formula C15H12N2O3S and a molecular weight of 300.34 g/mol. Its IUPAC name is 6-methoxy-2-(4-nitrocyclohepta-1,3,5-trien-1-yl)-1,3-benzothiazole.
| Compound Name | 6-methoxy-2-(4-nitrocyclohepta-1,3,5-trien-1-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 143429124 |
| Molecular Formula | C15H12N2O3S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 6-methoxy-2-(4-nitrocyclohepta-1,3,5-trien-1-yl)-1,3-benzothiazole |
| SMILES | COc1ccc2nc(C3=CC=C([N+](=O)[O-])C=CC3)sc2c1 |
| InChI | InChI=1S/C15H12N2O3S/c1-20-12-7-8-13-14(9-12)21-15(16-13)10-3-2-4-11(6-5-10)17(18)19/h2,4-9H,3H2,1H3 |
| InChIKey | IDYVOYYKEODDKN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|