C21H37N3 — CID 143430267
N-cyclohexyl-2,3-diethyl-6-methyl-5-(methyliminomethyl)pyridin-4-amine;propane (PubChem CID 143430267) has the molecular formula C21H37N3 and a molecular weight of 331.55 g/mol. Its IUPAC name is N-cyclohexyl-2,3-diethyl-6-methyl-5-(methyliminomethyl)pyridin-4-amine;propane.
| Compound Name | N-cyclohexyl-2,3-diethyl-6-methyl-5-(methyliminomethyl)pyridin-4-amine;propane |
|---|---|
| PubChem CID | 143430267 |
| Molecular Formula | C21H37N3 |
| Molecular Weight | 331.55 g/mol |
| Exact Mass | 331.30 |
| IUPAC Name | N-cyclohexyl-2,3-diethyl-6-methyl-5-(methyliminomethyl)pyridin-4-amine;propane |
| SMILES | CCC.CCc1nc(C)c(/C=N/C)c(NC2CCCCC2)c1CC |
| InChI | InChI=1S/C18H29N3.C3H8/c1-5-15-17(6-2)20-13(3)16(12-19-4)18(15)21-14-10-8-7-9-11-14;1-3-2/h12,14H,5-11H2,1-4H3,(H,20,21);3H2,1-2H3/b19-12+; |
| InChIKey | OBHBKBQVJHPWER-NNTHFVATSA-N |
| XLogP | 5.72 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.55 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|