C23H29NO — CID 143430486
(3Z)-5-[4-(4-butoxycyclohexyl)phenyl]-2-methylidenehexa-3,5-dienenitrile (PubChem CID 143430486) has the molecular formula C23H29NO and a molecular weight of 335.49 g/mol. Its IUPAC name is (3Z)-5-[4-(4-butoxycyclohexyl)phenyl]-2-methylidenehexa-3,5-dienenitrile.
| Compound Name | (3Z)-5-[4-(4-butoxycyclohexyl)phenyl]-2-methylidenehexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 143430486 |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | (3Z)-5-[4-(4-butoxycyclohexyl)phenyl]-2-methylidenehexa-3,5-dienenitrile |
| SMILES | C=C(C#N)/C=C\C(=C)c1ccc(C2CCC(OCCCC)CC2)cc1 |
| InChI | InChI=1S/C23H29NO/c1-4-5-16-25-23-14-12-22(13-15-23)21-10-8-20(9-11-21)19(3)7-6-18(2)17-24/h6-11,22-23H,2-5,12-16H2,1H3/b7-6- |
| InChIKey | IXGBKNDQYUNATG-SREVYHEPSA-N |
| XLogP | 6.18 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|