About 2-(2-methylhex-2-en-3-yl)phenol;bis(1,2-xylene)
2-(2-methylhex-2-en-3-yl)phenol;bis(1,2-xylene) (PubChem CID 143430727) has the molecular formula C29H38O
and a molecular weight of 402.62 g/mol. Its IUPAC name is 2-(2-methylhex-2-en-3-yl)phenol;bis(1,2-xylene).
Molecular Properties
| Compound Name | 2-(2-methylhex-2-en-3-yl)phenol;bis(1,2-xylene) |
| PubChem CID | 143430727 |
| Molecular Formula | C29H38O |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.29 |
| IUPAC Name | 2-(2-methylhex-2-en-3-yl)phenol;bis(1,2-xylene) |
| SMILES | CCCC(=C(C)C)c1ccccc1O.Cc1ccccc1C.Cc1ccccc1C |
| InChI | InChI=1S/C13H18O.2C8H10/c1-4-7-11(10(2)3)12-8-5-6-9-13(12)14;2*1-7-5-3-4-6-8(7)2/h5-6,8-9,14H,4,7H2,1-3H3;2*3-6H,1-2H3 |
| InChIKey | KKUYHNGYAJTARJ-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-methylhex-2-en-3-yl)phenol;bis(1,2-xylene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylhex-2-en-3-yl)phenol;bis(1,2-xylene)?
The IUPAC name of 2-(2-methylhex-2-en-3-yl)phenol;bis(1,2-xylene) (CID 143430727) is 2-(2-methylhex-2-en-3-yl)phenol;bis(1,2-xylene).
What is the SMILES notation for 2-(2-methylhex-2-en-3-yl)phenol;bis(1,2-xylene)?
The canonical SMILES for 2-(2-methylhex-2-en-3-yl)phenol;bis(1,2-xylene) is CCCC(=C(C)C)c1ccccc1O.Cc1ccccc1C.Cc1ccccc1C.
What is the InChIKey of 2-(2-methylhex-2-en-3-yl)phenol;bis(1,2-xylene)?
The InChIKey is KKUYHNGYAJTARJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O.2C8H10/c1-4-7-11(10(2)3)12-8-5-6-9-13(12)14;2*1-7-5-3-4-6-8(7)2/h5-6,8-9,14H,4,7H2,1-3H3;2*3-6H,1-2H3.
What are the key properties of 2-(2-methylhex-2-en-3-yl)phenol;bis(1,2-xylene)?
2-(2-methylhex-2-en-3-yl)phenol;bis(1,2-xylene) has a molecular weight of 402.62 g/mol, XLogP of 8.59, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylhex-2-en-3-yl)phenol;bis(1,2-xylene) is sourced from PubChem (CID 143430727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).