About 2-hex-2-en-3-ylphenol
2-hex-2-en-3-ylphenol (PubChem CID 57154775) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-hex-2-en-3-ylphenol.
Molecular Properties
| Compound Name | 2-hex-2-en-3-ylphenol |
| PubChem CID | 57154775 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 2-hex-2-en-3-ylphenol |
| SMILES | CC=C(CCC)c1ccccc1O |
| InChI | InChI=1S/C12H16O/c1-3-7-10(4-2)11-8-5-6-9-12(11)13/h4-6,8-9,13H,3,7H2,1-2H3 |
| InChIKey | UNJADCBECSDETJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-hex-2-en-3-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hex-2-en-3-ylphenol?
The IUPAC name of 2-hex-2-en-3-ylphenol (CID 57154775) is 2-hex-2-en-3-ylphenol.
What is the SMILES notation for 2-hex-2-en-3-ylphenol?
The canonical SMILES for 2-hex-2-en-3-ylphenol is CC=C(CCC)c1ccccc1O.
What is the InChIKey of 2-hex-2-en-3-ylphenol?
The InChIKey is UNJADCBECSDETJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c1-3-7-10(4-2)11-8-5-6-9-12(11)13/h4-6,8-9,13H,3,7H2,1-2H3.
What are the key properties of 2-hex-2-en-3-ylphenol?
2-hex-2-en-3-ylphenol has a molecular weight of 176.26 g/mol, XLogP of 3.60, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hex-2-en-3-ylphenol is sourced from PubChem (CID 57154775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).