C9H11N — CID 143431777
3,5-dimethyl-2-prop-2-ynyl-1H-pyrrole (PubChem CID 143431777) has the molecular formula C9H11N and a molecular weight of 133.19 g/mol. Its IUPAC name is 3,5-dimethyl-2-prop-2-ynyl-1H-pyrrole.
| Compound Name | 3,5-dimethyl-2-prop-2-ynyl-1H-pyrrole |
|---|---|
| PubChem CID | 143431777 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 3,5-dimethyl-2-prop-2-ynyl-1H-pyrrole |
| SMILES | C#CCc1[nH]c(C)cc1C |
| InChI | InChI=1S/C9H11N/c1-4-5-9-7(2)6-8(3)10-9/h1,6,10H,5H2,2-3H3 |
| InChIKey | NTQMZOHNRJEFGG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|