C21H26FN5O — CID 143432339
1-[4-amino-5-(4-methylphenyl)-7-[3-(propylamino)propyl]pyrrolo[2,3-d]pyrimidin-6-yl]-2-fluoroethanone (PubChem CID 143432339) has the molecular formula C21H26FN5O and a molecular weight of 383.47 g/mol. Its IUPAC name is 1-[4-amino-5-(4-methylphenyl)-7-[3-(propylamino)propyl]pyrrolo[2,3-d]pyrimidin-6-yl]-2-fluoroethanone.
| Compound Name | 1-[4-amino-5-(4-methylphenyl)-7-[3-(propylamino)propyl]pyrrolo[2,3-d]pyrimidin-6-yl]-2-fluoroethanone |
|---|---|
| PubChem CID | 143432339 |
| Molecular Formula | C21H26FN5O |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 1-[4-amino-5-(4-methylphenyl)-7-[3-(propylamino)propyl]pyrrolo[2,3-d]pyrimidin-6-yl]-2-fluoroethanone |
| SMILES | CCCNCCCn1c(C(=O)CF)c(-c2ccc(C)cc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C21H26FN5O/c1-3-9-24-10-4-11-27-19(16(28)12-22)17(15-7-5-14(2)6-8-15)18-20(23)25-13-26-21(18)27/h5-8,13,24H,3-4,9-12H2,1-2H3,(H2,23,25,26) |
| InChIKey | YTWZAFDMWUITOO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|