C23H25N5O3 — CID 159424336
(Z)-1-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-6-hydroxy-2-isocyanohex-1-en-3-one (PubChem CID 159424336) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is (Z)-1-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-6-hydroxy-2-isocyanohex-1-en-3-one.
| Compound Name | (Z)-1-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-6-hydroxy-2-isocyanohex-1-en-3-one |
|---|---|
| PubChem CID | 159424336 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | (Z)-1-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-6-hydroxy-2-isocyanohex-1-en-3-one |
| SMILES | [C-]#[N+]/C(=C\c1c(-c2ccc(C)cc2)c2c(N)ncnc2n1CCCO)C(=O)CCCO |
| InChI | InChI=1S/C23H25N5O3/c1-15-6-8-16(9-7-15)20-18(13-17(25-2)19(31)5-3-11-29)28(10-4-12-30)23-21(20)22(24)26-14-27-23/h6-9,13-14,29-30H,3-5,10-12H2,1H3,(H2,24,26,27)/b17-13- |
| InChIKey | VVJJMRNRAKVEPH-LGMDPLHJSA-N |
| XLogP | 2.97 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|