About formaldehyde;1-methyl-4-(3-piperidin-1-ylpropyl)piperazine;propane
formaldehyde;1-methyl-4-(3-piperidin-1-ylpropyl)piperazine;propane (PubChem CID 143432580) has the molecular formula C17H37N3O
and a molecular weight of 299.50 g/mol. Its IUPAC name is formaldehyde;1-methyl-4-(3-piperidin-1-ylpropyl)piperazine;propane.
Molecular Properties
| Compound Name | formaldehyde;1-methyl-4-(3-piperidin-1-ylpropyl)piperazine;propane |
| PubChem CID | 143432580 |
| Molecular Formula | C17H37N3O |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.29 |
| IUPAC Name | formaldehyde;1-methyl-4-(3-piperidin-1-ylpropyl)piperazine;propane |
| SMILES | C=O.CCC.CN1CCN(CCCN2CCCCC2)CC1 |
| InChI | InChI=1S/C13H27N3.C3H8.CH2O/c1-14-10-12-16(13-11-14)9-5-8-15-6-3-2-4-7-15;1-3-2;1-2/h2-13H2,1H3;3H2,1-2H3;1H2 |
| InChIKey | WLJRLVQIXLSPKB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze formaldehyde;1-methyl-4-(3-piperidin-1-ylpropyl)piperazine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;1-methyl-4-(3-piperidin-1-ylpropyl)piperazine;propane?
The IUPAC name of formaldehyde;1-methyl-4-(3-piperidin-1-ylpropyl)piperazine;propane (CID 143432580) is formaldehyde;1-methyl-4-(3-piperidin-1-ylpropyl)piperazine;propane.
What is the SMILES notation for formaldehyde;1-methyl-4-(3-piperidin-1-ylpropyl)piperazine;propane?
The canonical SMILES for formaldehyde;1-methyl-4-(3-piperidin-1-ylpropyl)piperazine;propane is C=O.CCC.CN1CCN(CCCN2CCCCC2)CC1.
What is the InChIKey of formaldehyde;1-methyl-4-(3-piperidin-1-ylpropyl)piperazine;propane?
The InChIKey is WLJRLVQIXLSPKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3.C3H8.CH2O/c1-14-10-12-16(13-11-14)9-5-8-15-6-3-2-4-7-15;1-3-2;1-2/h2-13H2,1H3;3H2,1-2H3;1H2.
What are the key properties of formaldehyde;1-methyl-4-(3-piperidin-1-ylpropyl)piperazine;propane?
formaldehyde;1-methyl-4-(3-piperidin-1-ylpropyl)piperazine;propane has a molecular weight of 299.50 g/mol, XLogP of 2.34, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;1-methyl-4-(3-piperidin-1-ylpropyl)piperazine;propane is sourced from PubChem (CID 143432580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).