C26H25NO2 — CID 143433108
3-[2-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-5-(2-phenylethyl)pyrrol-1-yl]benzoic acid (PubChem CID 143433108) has the molecular formula C26H25NO2 and a molecular weight of 383.49 g/mol. Its IUPAC name is 3-[2-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-5-(2-phenylethyl)pyrrol-1-yl]benzoic acid.
| Compound Name | 3-[2-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-5-(2-phenylethyl)pyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 143433108 |
| Molecular Formula | C26H25NO2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 3-[2-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-5-(2-phenylethyl)pyrrol-1-yl]benzoic acid |
| SMILES | C/C=C\C=C/C=C/c1ccc(CCc2ccccc2)n1-c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C26H25NO2/c1-2-3-4-5-9-14-23-18-19-24(17-16-21-11-7-6-8-12-21)27(23)25-15-10-13-22(20-25)26(28)29/h2-15,18-20H,16-17H2,1H3,(H,28,29)/b3-2-,5-4-,14-9+ |
| InChIKey | WSUFKNUHRYYARE-YMLPOWIPSA-N |
| XLogP | 6.11 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|