C13H27N3 — CID 143433371
N-[(1Z)-buta-1,3-dienyl]methanimine;1,4-dimethylpiperazine;ethane (PubChem CID 143433371) has the molecular formula C13H27N3 and a molecular weight of 225.38 g/mol. Its IUPAC name is N-[(1Z)-buta-1,3-dienyl]methanimine;1,4-dimethylpiperazine;ethane.
| Compound Name | N-[(1Z)-buta-1,3-dienyl]methanimine;1,4-dimethylpiperazine;ethane |
|---|---|
| PubChem CID | 143433371 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | N-[(1Z)-buta-1,3-dienyl]methanimine;1,4-dimethylpiperazine;ethane |
| SMILES | C=C/C=C\N=C.CC.CN1CCN(C)CC1 |
| InChI | InChI=1S/C6H14N2.C5H7N.C2H6/c1-7-3-5-8(2)6-4-7;1-3-4-5-6-2;1-2/h3-6H2,1-2H3;3-5H,1-2H2;1-2H3/b;5-4-; |
| InChIKey | ZTZPUIOMVSIDRC-FXHNQCOHSA-N |
| XLogP | 2.28 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|