C11H21N3 — CID 143680758
N-ethyl-N,N'-dimethyl-N'-[(3Z)-4-(methylideneamino)buta-1,3-dien-2-yl]ethane-1,2-diamine (PubChem CID 143680758) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is N-ethyl-N,N'-dimethyl-N'-[(3Z)-4-(methylideneamino)buta-1,3-dien-2-yl]ethane-1,2-diamine.
| Compound Name | N-ethyl-N,N'-dimethyl-N'-[(3Z)-4-(methylideneamino)buta-1,3-dien-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 143680758 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | N-ethyl-N,N'-dimethyl-N'-[(3Z)-4-(methylideneamino)buta-1,3-dien-2-yl]ethane-1,2-diamine |
| SMILES | C=N/C=C\C(=C)N(C)CCN(C)CC |
| InChI | InChI=1S/C11H21N3/c1-6-13(4)9-10-14(5)11(2)7-8-12-3/h7-8H,2-3,6,9-10H2,1,4-5H3/b8-7- |
| InChIKey | LYLUIISMOIFHGE-FPLPWBNLSA-N |
| XLogP | 1.60 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|