C27H32BrN3O3 — CID 143434097
(E)-2-[1-(4-bromophenyl)ethenyl]-1-[5-(4-cyclopentylpiperazine-1-carbonyl)-1H-pyrrol-3-yl]-3-methoxybut-2-en-1-one (PubChem CID 143434097) has the molecular formula C27H32BrN3O3 and a molecular weight of 526.48 g/mol. Its IUPAC name is (E)-2-[1-(4-bromophenyl)ethenyl]-1-[5-(4-cyclopentylpiperazine-1-carbonyl)-1H-pyrrol-3-yl]-3-methoxybut-2-en-1-one.
| Compound Name | (E)-2-[1-(4-bromophenyl)ethenyl]-1-[5-(4-cyclopentylpiperazine-1-carbonyl)-1H-pyrrol-3-yl]-3-methoxybut-2-en-1-one |
|---|---|
| PubChem CID | 143434097 |
| Molecular Formula | C27H32BrN3O3 |
| Molecular Weight | 526.48 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | (E)-2-[1-(4-bromophenyl)ethenyl]-1-[5-(4-cyclopentylpiperazine-1-carbonyl)-1H-pyrrol-3-yl]-3-methoxybut-2-en-1-one |
| SMILES | C=C(/C(C(=O)c1c[nH]c(C(=O)N2CCN(C3CCCC3)CC2)c1)=C(/C)OC)c1ccc(Br)cc1 |
| InChI | InChI=1S/C27H32BrN3O3/c1-18(20-8-10-22(28)11-9-20)25(19(2)34-3)26(32)21-16-24(29-17-21)27(33)31-14-12-30(13-15-31)23-6-4-5-7-23/h8-11,16-17,23,29H,1,4-7,12-15H2,2-3H3/b25-19+ |
| InChIKey | GGDBMRWMGOPMNF-NCELDCMTSA-N |
| XLogP | 5.29 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|