C24H28N2O4 — CID 143434226
(E)-1-[5-(2,6-dimethylmorpholine-4-carbonyl)-1H-pyrrol-3-yl]-3-methoxy-2-(1-phenylethenyl)but-2-en-1-one (PubChem CID 143434226) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is (E)-1-[5-(2,6-dimethylmorpholine-4-carbonyl)-1H-pyrrol-3-yl]-3-methoxy-2-(1-phenylethenyl)but-2-en-1-one.
| Compound Name | (E)-1-[5-(2,6-dimethylmorpholine-4-carbonyl)-1H-pyrrol-3-yl]-3-methoxy-2-(1-phenylethenyl)but-2-en-1-one |
|---|---|
| PubChem CID | 143434226 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (E)-1-[5-(2,6-dimethylmorpholine-4-carbonyl)-1H-pyrrol-3-yl]-3-methoxy-2-(1-phenylethenyl)but-2-en-1-one |
| SMILES | C=C(/C(C(=O)c1c[nH]c(C(=O)N2CC(C)OC(C)C2)c1)=C(/C)OC)c1ccccc1 |
| InChI | InChI=1S/C24H28N2O4/c1-15-13-26(14-16(2)30-15)24(28)21-11-20(12-25-21)23(27)22(18(4)29-5)17(3)19-9-7-6-8-10-19/h6-12,15-16,25H,3,13-14H2,1-2,4-5H3/b22-18+ |
| InChIKey | VIOBYDSUHFIQRE-RELWKKBWSA-N |
| XLogP | 4.08 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|