C11H24N2 — CID 143436388
butane;N,3-dimethyl-N-(methylideneamino)but-2-en-2-amine (PubChem CID 143436388) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is butane;N,3-dimethyl-N-(methylideneamino)but-2-en-2-amine.
| Compound Name | butane;N,3-dimethyl-N-(methylideneamino)but-2-en-2-amine |
|---|---|
| PubChem CID | 143436388 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | butane;N,3-dimethyl-N-(methylideneamino)but-2-en-2-amine |
| SMILES | C=NN(C)C(C)=C(C)C.CCCC |
| InChI | InChI=1S/C7H14N2.C4H10/c1-6(2)7(3)9(5)8-4;1-3-4-2/h4H2,1-3,5H3;3-4H2,1-2H3 |
| InChIKey | NKMGAHWTLRYTPO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|