C24H28N4O2 — CID 143437694
(E,E)-1-(1H-indol-6-yl)-3-morpholin-4-yl-N-[1-(pyridin-2-ylmethoxy)ethyl]but-2-en-1-imine (PubChem CID 143437694) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is (E,E)-1-(1H-indol-6-yl)-3-morpholin-4-yl-N-[1-(pyridin-2-ylmethoxy)ethyl]but-2-en-1-imine.
| Compound Name | (E,E)-1-(1H-indol-6-yl)-3-morpholin-4-yl-N-[1-(pyridin-2-ylmethoxy)ethyl]but-2-en-1-imine |
|---|---|
| PubChem CID | 143437694 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (E,E)-1-(1H-indol-6-yl)-3-morpholin-4-yl-N-[1-(pyridin-2-ylmethoxy)ethyl]but-2-en-1-imine |
| SMILES | C/C(=C\C(=N/C(C)OCc1ccccn1)c1ccc2cc[nH]c2c1)N1CCOCC1 |
| InChI | InChI=1S/C24H28N4O2/c1-18(28-11-13-29-14-12-28)15-24(21-7-6-20-8-10-26-23(20)16-21)27-19(2)30-17-22-5-3-4-9-25-22/h3-10,15-16,19,26H,11-14,17H2,1-2H3/b18-15+,27-24+ |
| InChIKey | FSDSRKUIZIUJIQ-ANRKDDBQSA-N |
| XLogP | 4.15 |
| TPSA | 62.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|