C19H19FN4O2 — CID 143437771
3-[(4-fluorophenyl)methyl]-7-hydroxy-1-(methylaminomethyl)-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-6-one (PubChem CID 143437771) has the molecular formula C19H19FN4O2 and a molecular weight of 354.39 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-7-hydroxy-1-(methylaminomethyl)-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-6-one.
| Compound Name | 3-[(4-fluorophenyl)methyl]-7-hydroxy-1-(methylaminomethyl)-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-6-one |
|---|---|
| PubChem CID | 143437771 |
| Molecular Formula | C19H19FN4O2 |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-7-hydroxy-1-(methylaminomethyl)-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-6-one |
| SMILES | CNCc1cn(Cc2ccc(F)cc2)c2cnc3c(c12)CCN(O)C3=O |
| InChI | InChI=1S/C19H19FN4O2/c1-21-8-13-11-23(10-12-2-4-14(20)5-3-12)16-9-22-18-15(17(13)16)6-7-24(26)19(18)25/h2-5,9,11,21,26H,6-8,10H2,1H3 |
| InChIKey | RTCOTGKXEDWPEA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|