C21H20F4N4O2 — CID 58869242
3-[(4-fluorophenyl)methyl]-7-hydroxy-1-[2-(2,2,2-trifluoroethylamino)ethyl]-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-6-one (PubChem CID 58869242) has the molecular formula C21H20F4N4O2 and a molecular weight of 436.41 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-7-hydroxy-1-[2-(2,2,2-trifluoroethylamino)ethyl]-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-6-one.
| Compound Name | 3-[(4-fluorophenyl)methyl]-7-hydroxy-1-[2-(2,2,2-trifluoroethylamino)ethyl]-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-6-one |
|---|---|
| PubChem CID | 58869242 |
| Molecular Formula | C21H20F4N4O2 |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-7-hydroxy-1-[2-(2,2,2-trifluoroethylamino)ethyl]-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-6-one |
| SMILES | O=C1c2ncc3c(c(CCNCC(F)(F)F)cn3Cc3ccc(F)cc3)c2CCN1O |
| InChI | InChI=1S/C21H20F4N4O2/c22-15-3-1-13(2-4-15)10-28-11-14(5-7-26-12-21(23,24)25)18-16-6-8-29(31)20(30)19(16)27-9-17(18)28/h1-4,9,11,26,31H,5-8,10,12H2 |
| InChIKey | WZQQJNZEXRJCDI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|