C24H27FN5O3+ — CID 91431201
(2R)-1-[[3-[(4-fluorophenyl)methyl]-7-hydroxy-6-oxo-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-1-yl]methyl]-2-methylpyrrolidin-1-ium-1-carboxamide (PubChem CID 91431201) has the molecular formula C24H27FN5O3+ and a molecular weight of 452.51 g/mol. Its IUPAC name is (2R)-1-[[3-[(4-fluorophenyl)methyl]-7-hydroxy-6-oxo-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-1-yl]methyl]-2-methylpyrrolidin-1-ium-1-carboxamide.
| Compound Name | (2R)-1-[[3-[(4-fluorophenyl)methyl]-7-hydroxy-6-oxo-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-1-yl]methyl]-2-methylpyrrolidin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 91431201 |
| Molecular Formula | C24H27FN5O3+ |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | (2R)-1-[[3-[(4-fluorophenyl)methyl]-7-hydroxy-6-oxo-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-1-yl]methyl]-2-methylpyrrolidin-1-ium-1-carboxamide |
| SMILES | C[C@@H]1CCC[N+]1(Cc1cn(Cc2ccc(F)cc2)c2cnc3c(c12)CCN(O)C3=O)C(N)=O |
| InChI | InChI=1S/C24H26FN5O3/c1-15-3-2-10-30(15,24(26)32)14-17-13-28(12-16-4-6-18(25)7-5-16)20-11-27-22-19(21(17)20)8-9-29(33)23(22)31/h4-7,11,13,15,33H,2-3,8-10,12,14H2,1H3,(H-,26,32)/p+1/t15-,30?/m1/s1 |
| InChIKey | ZMLZZRDHOKNFPM-BBUZXQMBSA-O |
| XLogP | 3.19 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|