C15H12FN5O — CID 143438229
N'-amino-3-fluoro-4-(3-phenyl-1,2,4-oxadiazol-5-yl)benzenecarboximidamide (PubChem CID 143438229) has the molecular formula C15H12FN5O and a molecular weight of 297.29 g/mol. Its IUPAC name is N'-amino-3-fluoro-4-(3-phenyl-1,2,4-oxadiazol-5-yl)benzenecarboximidamide.
| Compound Name | N'-amino-3-fluoro-4-(3-phenyl-1,2,4-oxadiazol-5-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 143438229 |
| Molecular Formula | C15H12FN5O |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N'-amino-3-fluoro-4-(3-phenyl-1,2,4-oxadiazol-5-yl)benzenecarboximidamide |
| SMILES | N/N=C(\N)c1ccc(-c2nc(-c3ccccc3)no2)c(F)c1 |
| InChI | InChI=1S/C15H12FN5O/c16-12-8-10(13(17)20-18)6-7-11(12)15-19-14(21-22-15)9-4-2-1-3-5-9/h1-8H,18H2,(H2,17,20) |
| InChIKey | NZMUSFWCDIQXDY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|