C13H15N3S — CID 143439241
ethane;7-methyl-5-thiophen-2-ylpyrazolo[1,5-a]pyrimidine (PubChem CID 143439241) has the molecular formula C13H15N3S and a molecular weight of 245.35 g/mol. Its IUPAC name is ethane;7-methyl-5-thiophen-2-ylpyrazolo[1,5-a]pyrimidine.
| Compound Name | ethane;7-methyl-5-thiophen-2-ylpyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 143439241 |
| Molecular Formula | C13H15N3S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | ethane;7-methyl-5-thiophen-2-ylpyrazolo[1,5-a]pyrimidine |
| SMILES | CC.Cc1cc(-c2cccs2)nc2ccnn12 |
| InChI | InChI=1S/C11H9N3S.C2H6/c1-8-7-9(10-3-2-6-15-10)13-11-4-5-12-14(8)11;1-2/h2-7H,1H3;1-2H3 |
| InChIKey | LONKJPPVUUFCFT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |