C12H11N3S — CID 51345972
5,7-dimethyl-3-thiophen-2-ylpyrazolo[1,5-a]pyrimidine (PubChem CID 51345972) has the molecular formula C12H11N3S and a molecular weight of 229.31 g/mol. Its IUPAC name is 5,7-dimethyl-3-thiophen-2-ylpyrazolo[1,5-a]pyrimidine.
| Compound Name | 5,7-dimethyl-3-thiophen-2-ylpyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 51345972 |
| Molecular Formula | C12H11N3S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 5,7-dimethyl-3-thiophen-2-ylpyrazolo[1,5-a]pyrimidine |
| SMILES | Cc1cc(C)n2ncc(-c3cccs3)c2n1 |
| InChI | InChI=1S/C12H11N3S/c1-8-6-9(2)15-12(14-8)10(7-13-15)11-4-3-5-16-11/h3-7H,1-2H3 |
| InChIKey | TWLVZOYXHFXELW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |