C12H10ClN3S — CID 82269997
7-chloro-5-ethyl-2-thiophen-2-ylpyrazolo[1,5-a]pyrimidine (PubChem CID 82269997) has the molecular formula C12H10ClN3S and a molecular weight of 263.75 g/mol. Its IUPAC name is 7-chloro-5-ethyl-2-thiophen-2-ylpyrazolo[1,5-a]pyrimidine.
| Compound Name | 7-chloro-5-ethyl-2-thiophen-2-ylpyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 82269997 |
| Molecular Formula | C12H10ClN3S |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 7-chloro-5-ethyl-2-thiophen-2-ylpyrazolo[1,5-a]pyrimidine |
| SMILES | CCc1cc(Cl)n2nc(-c3cccs3)cc2n1 |
| InChI | InChI=1S/C12H10ClN3S/c1-2-8-6-11(13)16-12(14-8)7-9(15-16)10-4-3-5-17-10/h3-7H,2H2,1H3 |
| InChIKey | JXOUTCCSHSUCMO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |