C12H13N5S — CID 82270412
(5,6-dimethyl-2-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)hydrazine (PubChem CID 82270412) has the molecular formula C12H13N5S and a molecular weight of 259.34 g/mol. Its IUPAC name is (5,6-dimethyl-2-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)hydrazine.
| Compound Name | (5,6-dimethyl-2-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)hydrazine |
|---|---|
| PubChem CID | 82270412 |
| Molecular Formula | C12H13N5S |
| Molecular Weight | 259.34 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | (5,6-dimethyl-2-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)hydrazine |
| SMILES | Cc1nc2cc(-c3cccs3)nn2c(NN)c1C |
| InChI | InChI=1S/C12H13N5S/c1-7-8(2)14-11-6-9(10-4-3-5-18-10)16-17(11)12(7)15-13/h3-6,15H,13H2,1-2H3 |
| InChIKey | OUJPEGLRICIVOJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|