C15H19N5S — CID 82270798
N'-(5-ethyl-2-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)propane-1,3-diamine (PubChem CID 82270798) has the molecular formula C15H19N5S and a molecular weight of 301.42 g/mol. Its IUPAC name is N'-(5-ethyl-2-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)propane-1,3-diamine.
| Compound Name | N'-(5-ethyl-2-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 82270798 |
| Molecular Formula | C15H19N5S |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N'-(5-ethyl-2-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)propane-1,3-diamine |
| SMILES | CCc1cc(NCCCN)n2nc(-c3cccs3)cc2n1 |
| InChI | InChI=1S/C15H19N5S/c1-2-11-9-14(17-7-4-6-16)20-15(18-11)10-12(19-20)13-5-3-8-21-13/h3,5,8-10,17H,2,4,6-7,16H2,1H3 |
| InChIKey | CJPMDVGEVAODRO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|