C20H30N5S+ — CID 7441022
diethyl-[3-[(6-ethyl-5-methyl-2-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)amino]propyl]azanium (PubChem CID 7441022) has the molecular formula C20H30N5S+ and a molecular weight of 372.56 g/mol. Its IUPAC name is diethyl-[3-[(6-ethyl-5-methyl-2-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)amino]propyl]azanium.
| Compound Name | diethyl-[3-[(6-ethyl-5-methyl-2-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)amino]propyl]azanium |
|---|---|
| PubChem CID | 7441022 |
| Molecular Formula | C20H30N5S+ |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | diethyl-[3-[(6-ethyl-5-methyl-2-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)amino]propyl]azanium |
| SMILES | CCc1c(C)nc2cc(-c3cccs3)nn2c1NCCC[NH+](CC)CC |
| InChI | InChI=1S/C20H29N5S/c1-5-16-15(4)22-19-14-17(18-10-8-13-26-18)23-25(19)20(16)21-11-9-12-24(6-2)7-3/h8,10,13-14,21H,5-7,9,11-12H2,1-4H3/p+1 |
| InChIKey | RVIJBCOZZQHURV-UHFFFAOYSA-O |
| XLogP | 3.06 |
| TPSA | 46.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|