C13H13N5S — CID 82270494
(11-thiophen-2-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)hydrazine (PubChem CID 82270494) has the molecular formula C13H13N5S and a molecular weight of 271.35 g/mol. Its IUPAC name is (11-thiophen-2-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)hydrazine.
| Compound Name | (11-thiophen-2-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)hydrazine |
|---|---|
| PubChem CID | 82270494 |
| Molecular Formula | C13H13N5S |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | (11-thiophen-2-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)hydrazine |
| SMILES | NNc1c2c(nc3cc(-c4cccs4)nn13)CCC2 |
| InChI | InChI=1S/C13H13N5S/c14-16-13-8-3-1-4-9(8)15-12-7-10(17-18(12)13)11-5-2-6-19-11/h2,5-7,16H,1,3-4,14H2 |
| InChIKey | UCEWNNJWCHEQRR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|