C15H18N5S+ — CID 7435463
2-[(11-thiophen-2-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)amino]ethylazanium (PubChem CID 7435463) has the molecular formula C15H18N5S+ and a molecular weight of 300.41 g/mol. Its IUPAC name is 2-[(11-thiophen-2-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)amino]ethylazanium.
| Compound Name | 2-[(11-thiophen-2-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)amino]ethylazanium |
|---|---|
| PubChem CID | 7435463 |
| Molecular Formula | C15H18N5S+ |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-[(11-thiophen-2-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)amino]ethylazanium |
| SMILES | [NH3+]CCNc1c2c(nc3cc(-c4cccs4)nn13)CCC2 |
| InChI | InChI=1S/C15H17N5S/c16-6-7-17-15-10-3-1-4-11(10)18-14-9-12(19-20(14)15)13-5-2-8-21-13/h2,5,8-9,17H,1,3-4,6-7,16H2/p+1 |
| InChIKey | GSPAQHFORZTIBT-UHFFFAOYSA-O |
| XLogP | 1.60 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |