C23H32N5+ — CID 7440614
[2,2-dimethyl-3-[[11-(3-methylphenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]amino]propyl]-dimethylazanium (PubChem CID 7440614) has the molecular formula C23H32N5+ and a molecular weight of 378.54 g/mol. Its IUPAC name is [2,2-dimethyl-3-[[11-(3-methylphenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]amino]propyl]-dimethylazanium.
| Compound Name | [2,2-dimethyl-3-[[11-(3-methylphenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]amino]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 7440614 |
| Molecular Formula | C23H32N5+ |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | [2,2-dimethyl-3-[[11-(3-methylphenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]amino]propyl]-dimethylazanium |
| SMILES | Cc1cccc(-c2cc3nc4c(c(NCC(C)(C)C[NH+](C)C)n3n2)CCC4)c1 |
| InChI | InChI=1S/C23H31N5/c1-16-8-6-9-17(12-16)20-13-21-25-19-11-7-10-18(19)22(28(21)26-20)24-14-23(2,3)15-27(4)5/h6,8-9,12-13,24H,7,10-11,14-15H2,1-5H3/p+1 |
| InChIKey | XRIYJJJJGFHBFG-UHFFFAOYSA-O |
| XLogP | 2.78 |
| TPSA | 46.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |