C16H14ClN3 — CID 82269902
2-chloro-11-(4-methylphenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene (PubChem CID 82269902) has the molecular formula C16H14ClN3 and a molecular weight of 283.76 g/mol. Its IUPAC name is 2-chloro-11-(4-methylphenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene.
| Compound Name | 2-chloro-11-(4-methylphenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
|---|---|
| PubChem CID | 82269902 |
| Molecular Formula | C16H14ClN3 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-chloro-11-(4-methylphenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
| SMILES | Cc1ccc(-c2cc3nc4c(c(Cl)n3n2)CCC4)cc1 |
| InChI | InChI=1S/C16H14ClN3/c1-10-5-7-11(8-6-10)14-9-15-18-13-4-2-3-12(13)16(17)20(15)19-14/h5-9H,2-4H2,1H3 |
| InChIKey | CEHWNVNQEASRKE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |