C14H11ClN4 — CID 82269909
2-chloro-11-pyridin-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene (PubChem CID 82269909) has the molecular formula C14H11ClN4 and a molecular weight of 270.72 g/mol. Its IUPAC name is 2-chloro-11-pyridin-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene.
| Compound Name | 2-chloro-11-pyridin-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
|---|---|
| PubChem CID | 82269909 |
| Molecular Formula | C14H11ClN4 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 2-chloro-11-pyridin-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
| SMILES | Clc1c2c(nc3cc(-c4cccnc4)nn13)CCC2 |
| InChI | InChI=1S/C14H11ClN4/c15-14-10-4-1-5-11(10)17-13-7-12(18-19(13)14)9-3-2-6-16-8-9/h2-3,6-8H,1,4-5H2 |
| InChIKey | SUMBSSVEMDRYNC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |