C22H25FN4 — CID 1441247
2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-11-(3-fluorophenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene (PubChem CID 1441247) has the molecular formula C22H25FN4 and a molecular weight of 364.47 g/mol. Its IUPAC name is 2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-11-(3-fluorophenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene.
| Compound Name | 2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-11-(3-fluorophenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
|---|---|
| PubChem CID | 1441247 |
| Molecular Formula | C22H25FN4 |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-11-(3-fluorophenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
| SMILES | C[C@@H]1C[C@H](C)CN(c2c3c(nc4cc(-c5cccc(F)c5)nn24)CCC3)C1 |
| InChI | InChI=1S/C22H25FN4/c1-14-9-15(2)13-26(12-14)22-18-7-4-8-19(18)24-21-11-20(25-27(21)22)16-5-3-6-17(23)10-16/h3,5-6,10-11,14-15H,4,7-9,12-13H2,1-2H3/t14-,15+ |
| InChIKey | KINUPNAIOFYFBF-GASCZTMLSA-N |
| XLogP | 4.51 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |